hydroxy(4-methylphenyl)acetic acid
HYDROXY-P-TOLYL-ACETIC ACID
CAS: 18584-20-8
Molecular Formula: C9H10O3
hydroxy(4-methylphenyl)acetic acid - Names and Identifiers
| Name | HYDROXY-P-TOLYL-ACETIC ACID |
| Synonyms | Nsc126594 4-METHYLMALDELIC ACID p-Methylmandelic acid P-METHYL MANDELIC ACID p-Methyl mandelic acid HYDROXY-P-TOLYL-ACETIC ACID p-Methylphenylhydroxyacetic ac hydroxy(4-methylphenyl)acetic acid Benzeneacetic acid, a-hydroxy-4-Methyl- alpha-Hydroxy-4-methylphenyl-acetic acid Hydroxy(4-methylphenyl)acetic acid, 4-[Carboxy(hydroxy)methyl]toluene |
| CAS | 18584-20-8 |
| InChI | InChI=1/C9H10O3/c1-6-2-4-7(5-3-6)8(10)9(11)12/h2-5,8,10H,1H3,(H,11,12) |
hydroxy(4-methylphenyl)acetic acid - Physico-chemical Properties
| Molecular Formula | C9H10O3 |
| Molar Mass | 166.18 |
| Density | 1.264±0.06 g/cm3(Predicted) |
| Melting Point | 145-146 °C |
| Boling Point | 336.4±27.0 °C(Predicted) |
| Flash Point | 171.4°C |
| Vapor Presure | 4.41E-05mmHg at 25°C |
| pKa | 3.55±0.10(Predicted) |
| Storage Condition | Room Temprature |
| Refractive Index | 1.579 |
hydroxy(4-methylphenyl)acetic acid - Risk and Safety
| Hazard Symbols | Xi - Irritant |
hydroxy(4-methylphenyl)acetic acid - Introduction
Methylbenzylacetic acid, chemical formula C8H8O3, is an organic compound. The following is an introduction to the nature, use, preparation and safety information of HYDROXY-P-TOLYL-ACETIC ACID:
Nature:
1. Appearance: methylbenzylhydroxyacetic acid is a colorless crystalline solid.
2. Melting Point: about 145 ℃.
3. Solubility: Soluble in water and ethanol.
Use:
1. Medical field: methyl benzoylacetic acid is an over-the-counter drug, commonly used for the treatment of headache, fever, pain and other symptoms, and has anti-inflammatory effect.
2. Cosmetics field: methylbenzylhydroxyacetic acid can be used as antioxidants, preservatives and moisturizers in some cosmetics.
Method:
The preparation methods of methyl benzoylacetic acid mainly include the following:
1. Through the reaction of methyl benzoate and sodium hypochlorite to generate methylbenzylhydroxyacetic acid.
2. Through the reaction of benzyl alcohol and oxidants (such as oxygen, hydrogen peroxide) to generate methylbenzylhydroxyacetic acid.
Safety Information:
1. Methylbenzylacetic acid is stable and non-toxic at room temperature, but it is still necessary to avoid inhalation, contact with skin and swallowing.
2. In the use of methyl hydroxyacetic acid, should wear gloves, goggles, keep indoor ventilation.
3. If accidental contact or inhalation of methylbenzylhydroxyacetic acid, please wash immediately with plenty of water, and medical treatment.
Nature:
1. Appearance: methylbenzylhydroxyacetic acid is a colorless crystalline solid.
2. Melting Point: about 145 ℃.
3. Solubility: Soluble in water and ethanol.
Use:
1. Medical field: methyl benzoylacetic acid is an over-the-counter drug, commonly used for the treatment of headache, fever, pain and other symptoms, and has anti-inflammatory effect.
2. Cosmetics field: methylbenzylhydroxyacetic acid can be used as antioxidants, preservatives and moisturizers in some cosmetics.
Method:
The preparation methods of methyl benzoylacetic acid mainly include the following:
1. Through the reaction of methyl benzoate and sodium hypochlorite to generate methylbenzylhydroxyacetic acid.
2. Through the reaction of benzyl alcohol and oxidants (such as oxygen, hydrogen peroxide) to generate methylbenzylhydroxyacetic acid.
Safety Information:
1. Methylbenzylacetic acid is stable and non-toxic at room temperature, but it is still necessary to avoid inhalation, contact with skin and swallowing.
2. In the use of methyl hydroxyacetic acid, should wear gloves, goggles, keep indoor ventilation.
3. If accidental contact or inhalation of methylbenzylhydroxyacetic acid, please wash immediately with plenty of water, and medical treatment.
Last Update：2024-04-09 02:00:43
Supplier List
Product Name: HYDROXY-P-TOLYL-ACETIC ACID Visit Supplier Webpage Request for quotation
CAS: 18584-20-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 18584-20-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: HYDROXY-P-TOLYL-ACETIC ACID Visit Supplier Webpage Request for quotation
CAS: 18584-20-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 18584-20-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History